C50H50N2O4 — CID 66923542
1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]cyclobutane-1,1-dicarboxamide (PubChem CID 66923542) has the molecular formula C50H50N2O4 and a molecular weight of 742.96 g/mol. Its IUPAC name is 1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923542 |
| Molecular Formula | C50H50N2O4 |
| Molecular Weight | 742.96 g/mol |
| Exact Mass | 742.38 |
| IUPAC Name | 1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]cyclobutane-1,1-dicarboxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@@H](c2ccccc2)N(C(=O)C2(C(N)=O)CCC2)[C@H](c2ccccc2)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C50H50N2O4/c1-34-16-24-40(25-17-34)49(55,41-26-18-35(2)19-27-41)44(38-12-7-5-8-13-38)52(47(54)48(46(51)53)32-11-33-48)45(39-14-9-6-10-15-39)50(56,42-28-20-36(3)21-29-42)43-30-22-37(4)23-31-43/h5-10,12-31,44-45,55-56H,11,32-33H2,1-4H3,(H2,51,53)/t44-,45-/m1/s1 |
| InChIKey | STQVNCKVWBRKBC-GSFSDPDBSA-N |
| XLogP | 9.06 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.96 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|