C52H54N2O8 — CID 66923593
1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(2-methoxyphenyl)-1-phenylethyl]cyclohexane-1,1-dicarboxamide (PubChem CID 66923593) has the molecular formula C52H54N2O8 and a molecular weight of 835.01 g/mol. Its IUPAC name is 1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(2-methoxyphenyl)-1-phenylethyl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(2-methoxyphenyl)-1-phenylethyl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923593 |
| Molecular Formula | C52H54N2O8 |
| Molecular Weight | 835.01 g/mol |
| Exact Mass | 834.39 |
| IUPAC Name | 1-N',1-N'-bis[(1R)-2-hydroxy-2,2-bis(2-methoxyphenyl)-1-phenylethyl]cyclohexane-1,1-dicarboxamide |
| SMILES | COc1ccccc1C(O)(c1ccccc1OC)[C@@H](c1ccccc1)N(C(=O)C1(C(N)=O)CCCCC1)[C@H](c1ccccc1)C(O)(c1ccccc1OC)c1ccccc1OC |
| InChI | InChI=1S/C52H54N2O8/c1-59-42-30-16-12-26-38(42)51(57,39-27-13-17-31-43(39)60-2)46(36-22-8-5-9-23-36)54(49(56)50(48(53)55)34-20-7-21-35-50)47(37-24-10-6-11-25-37)52(58,40-28-14-18-32-44(40)61-3)41-29-15-19-33-45(41)62-4/h5-6,8-19,22-33,46-47,57-58H,7,20-21,34-35H2,1-4H3,(H2,53,55)/t46-,47-/m1/s1 |
| InChIKey | ZOMJJRKXFKERPI-NZCKGYRVSA-N |
| XLogP | 8.64 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.01 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|