C21H40N2O4 — CID 77217685
1-N',1-N'-bis(3-ethyl-3-hydroxypentan-2-yl)cyclopentane-1,1-dicarboxamide (PubChem CID 77217685) has the molecular formula C21H40N2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-N',1-N'-bis(3-ethyl-3-hydroxypentan-2-yl)cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis(3-ethyl-3-hydroxypentan-2-yl)cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 77217685 |
| Molecular Formula | C21H40N2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 1-N',1-N'-bis(3-ethyl-3-hydroxypentan-2-yl)cyclopentane-1,1-dicarboxamide |
| SMILES | CCC(O)(CC)C(C)N(C(=O)C1(C(N)=O)CCCC1)C(C)C(O)(CC)CC |
| InChI | InChI=1S/C21H40N2O4/c1-7-20(26,8-2)15(5)23(16(6)21(27,9-3)10-4)18(25)19(17(22)24)13-11-12-14-19/h15-16,26-27H,7-14H2,1-6H3,(H2,22,24) |
| InChIKey | MGRPXODOYSGQGF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|