C20H34N2O4 — CID 77217600
1-N',1-N'-bis[1-(1-hydroxycyclobutyl)ethyl]cyclohexane-1,1-dicarboxamide (PubChem CID 77217600) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-N',1-N'-bis[1-(1-hydroxycyclobutyl)ethyl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[1-(1-hydroxycyclobutyl)ethyl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 77217600 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 1-N',1-N'-bis[1-(1-hydroxycyclobutyl)ethyl]cyclohexane-1,1-dicarboxamide |
| SMILES | CC(N(C(=O)C1(C(N)=O)CCCCC1)C(C)C1(O)CCC1)C1(O)CCC1 |
| InChI | InChI=1S/C20H34N2O4/c1-14(19(25)10-6-11-19)22(15(2)20(26)12-7-13-20)17(24)18(16(21)23)8-4-3-5-9-18/h14-15,25-26H,3-13H2,1-2H3,(H2,21,23) |
| InChIKey | SPBVRVQXQUQQDS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|