About 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol
2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol (PubChem CID 174748653) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol |
| PubChem CID | 174748653 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C(=O)O.CC(C)C1(O)CCCCC1 |
| InChI | InChI=1S/C9H18O.C4H8O2/c1-8(2)9(10)6-4-3-5-7-9;1-3(2)4(5)6/h8,10H,3-7H2,1-2H3;3H,1-2H3,(H,5,6) |
| InChIKey | NJBUSSLXYGHWBG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol?
The IUPAC name of 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol (CID 174748653) is 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol.
What is the SMILES notation for 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol?
The canonical SMILES for 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol is CC(C)C(=O)O.CC(C)C1(O)CCCCC1.
What is the InChIKey of 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol?
The InChIKey is NJBUSSLXYGHWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C4H8O2/c1-8(2)9(10)6-4-3-5-7-9;1-3(2)4(5)6/h8,10H,3-7H2,1-2H3;3H,1-2H3,(H,5,6).
What are the key properties of 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol?
2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol has a molecular weight of 230.35 g/mol, XLogP of 3.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoic acid;1-propan-2-ylcyclohexan-1-ol is sourced from PubChem (CID 174748653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).