C31H40N2O4 — CID 77217431
1-N',1-N'-bis[1-(1-hydroxycyclobutyl)-2-phenylethyl]cyclopentane-1,1-dicarboxamide (PubChem CID 77217431) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is 1-N',1-N'-bis[1-(1-hydroxycyclobutyl)-2-phenylethyl]cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[1-(1-hydroxycyclobutyl)-2-phenylethyl]cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 77217431 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 1-N',1-N'-bis[1-(1-hydroxycyclobutyl)-2-phenylethyl]cyclopentane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(C(Cc2ccccc2)C2(O)CCC2)C(Cc2ccccc2)C2(O)CCC2)CCCC1 |
| InChI | InChI=1S/C31H40N2O4/c32-27(34)29(15-7-8-16-29)28(35)33(25(30(36)17-9-18-30)21-23-11-3-1-4-12-23)26(31(37)19-10-20-31)22-24-13-5-2-6-14-24/h1-6,11-14,25-26,36-37H,7-10,15-22H2,(H2,32,34) |
| InChIKey | KFDFEJDYWHEABH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|