C23H28N2O4 — CID 66923768
1-N',1-N'-bis[(2R)-1-hydroxy-3-phenylpropan-2-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 66923768) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-N',1-N'-bis[(2R)-1-hydroxy-3-phenylpropan-2-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(2R)-1-hydroxy-3-phenylpropan-2-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923768 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-N',1-N'-bis[(2R)-1-hydroxy-3-phenylpropan-2-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N([C@@H](CO)Cc2ccccc2)[C@@H](CO)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N2O4/c24-21(28)23(11-12-23)22(29)25(19(15-26)13-17-7-3-1-4-8-17)20(16-27)14-18-9-5-2-6-10-18/h1-10,19-20,26-27H,11-16H2,(H2,24,28)/t19-,20-/m1/s1 |
| InChIKey | RLDMAGCDDWMBIF-WOJBJXKFSA-N |
| XLogP | 1.29 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|