C24H25NO3 — CID 68778684
4-[1-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]oxybenzoic acid (PubChem CID 68778684) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[1-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]oxybenzoic acid.
| Compound Name | 4-[1-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]oxybenzoic acid |
|---|---|
| PubChem CID | 68778684 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[1-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]oxybenzoic acid |
| SMILES | C[C@@H](NC1(Oc2ccc(C(=O)O)cc2)CCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H25NO3/c1-17(21-10-6-8-18-7-2-3-9-22(18)21)25-24(15-4-5-16-24)28-20-13-11-19(12-14-20)23(26)27/h2-3,6-14,17,25H,4-5,15-16H2,1H3,(H,26,27)/t17-/m1/s1 |
| InChIKey | BNKJOQZTTGUQJJ-QGZVFWFLSA-N |
| XLogP | 5.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|