C52H54N2O4 — CID 66923415
1-N,1-N'-bis[(2R)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]cyclobutane-1,1-dicarboxamide (PubChem CID 66923415) has the molecular formula C52H54N2O4 and a molecular weight of 771.01 g/mol. Its IUPAC name is 1-N,1-N'-bis[(2R)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(2R)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66923415 |
| Molecular Formula | C52H54N2O4 |
| Molecular Weight | 771.01 g/mol |
| Exact Mass | 770.41 |
| IUPAC Name | 1-N,1-N'-bis[(2R)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]cyclobutane-1,1-dicarboxamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(O)(Cc1ccccc1)Cc1ccccc1)C1(C(=O)N[C@H](Cc2ccccc2)C(O)(Cc2ccccc2)Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C52H54N2O4/c55-48(53-46(34-40-20-7-1-8-21-40)51(57,36-42-24-11-3-12-25-42)37-43-26-13-4-14-27-43)50(32-19-33-50)49(56)54-47(35-41-22-9-2-10-23-41)52(58,38-44-28-15-5-16-29-44)39-45-30-17-6-18-31-45/h1-18,20-31,46-47,57-58H,19,32-39H2,(H,53,55)(H,54,56)/t46-,47-/m1/s1 |
| InChIKey | GFQZVBPYVJKABR-NZCKGYRVSA-N |
| XLogP | 8.04 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.01 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|