C29H32N2O4 — CID 24746259
2-N,2-N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,3-dihydroindene-2,2-dicarboxamide (PubChem CID 24746259) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-N,2-N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,3-dihydroindene-2,2-dicarboxamide.
| Compound Name | 2-N,2-N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,3-dihydroindene-2,2-dicarboxamide |
|---|---|
| PubChem CID | 24746259 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-N,2-N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,3-dihydroindene-2,2-dicarboxamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)C1(C(=O)N[C@H](CO)Cc2ccccc2)Cc2ccccc2C1 |
| InChI | InChI=1S/C29H32N2O4/c32-19-25(15-21-9-3-1-4-10-21)30-27(34)29(17-23-13-7-8-14-24(23)18-29)28(35)31-26(20-33)16-22-11-5-2-6-12-22/h1-14,25-26,32-33H,15-20H2,(H,30,34)(H,31,35)/t25-,26-/m0/s1 |
| InChIKey | ZJQWMYVYJCQTAQ-UIOOFZCWSA-N |
| XLogP | 2.21 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|