C18H20N2O4 — CID 141074859
2,3-dihydroxy-2,3-bis(4-methylphenyl)butanediamide (PubChem CID 141074859) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(4-methylphenyl)butanediamide.
| Compound Name | 2,3-dihydroxy-2,3-bis(4-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 141074859 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(4-methylphenyl)butanediamide |
| SMILES | Cc1ccc(C(O)(C(N)=O)C(O)(C(N)=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-11-3-7-13(8-4-11)17(23,15(19)21)18(24,16(20)22)14-9-5-12(2)6-10-14/h3-10,23-24H,1-2H3,(H2,19,21)(H2,20,22) |
| InChIKey | YELQBSFKJDLTRO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |