C23H23NO — CID 20684858
2-(2-methylphenyl)-2,2-bis(4-methylphenyl)acetamide (PubChem CID 20684858) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-(2-methylphenyl)-2,2-bis(4-methylphenyl)acetamide.
| Compound Name | 2-(2-methylphenyl)-2,2-bis(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 20684858 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-(2-methylphenyl)-2,2-bis(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(C(N)=O)(c2ccc(C)cc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C23H23NO/c1-16-8-12-19(13-9-16)23(22(24)25,20-14-10-17(2)11-15-20)21-7-5-4-6-18(21)3/h4-15H,1-3H3,(H2,24,25) |
| InChIKey | MGRNEAYNOKPCNV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|