C23H22O2S — CID 87700821
sulfanyl 2,2,2-tris(4-methylphenyl)acetate (PubChem CID 87700821) has the molecular formula C23H22O2S and a molecular weight of 362.49 g/mol. Its IUPAC name is sulfanyl 2,2,2-tris(4-methylphenyl)acetate.
| Compound Name | sulfanyl 2,2,2-tris(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 87700821 |
| Molecular Formula | C23H22O2S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | sulfanyl 2,2,2-tris(4-methylphenyl)acetate |
| SMILES | Cc1ccc(C(C(=O)OS)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H22O2S/c1-16-4-10-19(11-5-16)23(22(24)25-26,20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15,26H,1-3H3 |
| InChIKey | KDBWPUPZEPDREZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|