C14H30N4O — CID 105261230
[1-(1,4-dimethyl-1,4-diazepan-2-yl)-3-(oxolan-2-yl)propyl]hydrazine (PubChem CID 105261230) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is [1-(1,4-dimethyl-1,4-diazepan-2-yl)-3-(oxolan-2-yl)propyl]hydrazine.
| Compound Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-3-(oxolan-2-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105261230 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-3-(oxolan-2-yl)propyl]hydrazine |
| SMILES | CN1CCCN(C)C(C(CCC2CCCO2)NN)C1 |
| InChI | InChI=1S/C14H30N4O/c1-17-8-4-9-18(2)14(11-17)13(16-15)7-6-12-5-3-10-19-12/h12-14,16H,3-11,15H2,1-2H3 |
| InChIKey | URZDELFVNWALFM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|