C11H24N4 — CID 105249829
1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pentylhydrazine (PubChem CID 105249829) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pentylhydrazine.
| Compound Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pentylhydrazine |
|---|---|
| PubChem CID | 105249829 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pentylhydrazine |
| SMILES | CCCCC(NN)C1CN2CCN1CC2 |
| InChI | InChI=1S/C11H24N4/c1-2-3-4-10(13-12)11-9-14-5-7-15(11)8-6-14/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | KAPPLBHRLCJGLF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|