C10H13N3O2 — CID 103714850
2-cyclopropylethyl 3-aminopyrazine-2-carboxylate (PubChem CID 103714850) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-cyclopropylethyl 3-aminopyrazine-2-carboxylate.
| Compound Name | 2-cyclopropylethyl 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 103714850 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-cyclopropylethyl 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCCC1CC1 |
| InChI | InChI=1S/C10H13N3O2/c11-9-8(12-4-5-13-9)10(14)15-6-3-7-1-2-7/h4-5,7H,1-3,6H2,(H2,11,13) |
| InChIKey | CIVHHFCKTUUJSJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |