C13H18N4O3 — CID 2685715
[2-(4-methylpiperidin-1-yl)-2-oxoethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 2685715) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2685715 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | CC1CCN(C(=O)COC(=O)c2nccnc2N)CC1 |
| InChI | InChI=1S/C13H18N4O3/c1-9-2-6-17(7-3-9)10(18)8-20-13(19)11-12(14)16-5-4-15-11/h4-5,9H,2-3,6-8H2,1H3,(H2,14,16) |
| InChIKey | OGCLMGNPMCRXBT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |