C12H16N4O3 — CID 2687681
(2-oxo-2-piperidin-1-ylethyl) 3-aminopyrazine-2-carboxylate (PubChem CID 2687681) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 3-aminopyrazine-2-carboxylate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2687681 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H16N4O3/c13-11-10(14-4-5-15-11)12(18)19-8-9(17)16-6-2-1-3-7-16/h4-5H,1-3,6-8H2,(H2,13,15) |
| InChIKey | RHPGCDUHCNKZSN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |