C18H17N5O3 — CID 30256642
[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 30256642) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 30256642 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCC(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C18H17N5O3/c19-17-16(20-6-7-21-17)18(25)26-10-15(24)23-8-5-14-12(9-23)11-3-1-2-4-13(11)22-14/h1-4,6-7,22H,5,8-10H2,(H2,19,21) |
| InChIKey | XKRUBWQZTWTIMK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|