C28H19ClN2O5 — CID 30454054
[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 30454054) has the molecular formula C28H19ClN2O5 and a molecular weight of 498.92 g/mol. Its IUPAC name is [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 30454054 |
| Molecular Formula | C28H19ClN2O5 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCc2[nH]c3ccccc3c2C1)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H19ClN2O5/c29-25-19(10-9-18-24(25)27(34)17-7-2-1-6-16(17)26(18)33)28(35)36-14-23(32)31-12-11-22-20(13-31)15-5-3-4-8-21(15)30-22/h1-10,30H,11-14H2 |
| InChIKey | ZEEMIGDVYKKMJU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|