C19H19N3O3S — CID 30258630
[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 30258630) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 30258630 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)OCC(=O)N2CCc3[nH]c4ccccc4c3C2)s1 |
| InChI | InChI=1S/C19H19N3O3S/c1-11-18(26-12(2)20-11)19(24)25-10-17(23)22-8-7-16-14(9-22)13-5-3-4-6-15(13)21-16/h3-6,21H,7-10H2,1-2H3 |
| InChIKey | ZGNCVERXQPGTRZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|