C20H21N3O2S — CID 41293735
N-[(1R)-3-oxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylpropyl]acetamide (PubChem CID 41293735) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[(1R)-3-oxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylpropyl]acetamide.
| Compound Name | N-[(1R)-3-oxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylpropyl]acetamide |
|---|---|
| PubChem CID | 41293735 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[(1R)-3-oxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylpropyl]acetamide |
| SMILES | CC(=O)N[C@H](CC(=O)N1CCc2[nH]c3ccccc3c2C1)c1cccs1 |
| InChI | InChI=1S/C20H21N3O2S/c1-13(24)21-18(19-7-4-10-26-19)11-20(25)23-9-8-17-15(12-23)14-5-2-3-6-16(14)22-17/h2-7,10,18,22H,8-9,11-12H2,1H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | LDTGMHZGGZEIOY-GOSISDBHSA-N |
| XLogP | 3.38 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|