C9H11N3O2 — CID 63259879
cyclopropylmethyl 3-aminopyrazine-2-carboxylate (PubChem CID 63259879) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is cyclopropylmethyl 3-aminopyrazine-2-carboxylate.
| Compound Name | cyclopropylmethyl 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 63259879 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | cyclopropylmethyl 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCC1CC1 |
| InChI | InChI=1S/C9H11N3O2/c10-8-7(11-3-4-12-8)9(13)14-5-6-1-2-6/h3-4,6H,1-2,5H2,(H2,10,12) |
| InChIKey | BZHXJUMBPXUSFD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |