C14H15N3O2 — CID 16594706
(2,5-dimethylphenyl)methyl 3-aminopyrazine-2-carboxylate (PubChem CID 16594706) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 3-aminopyrazine-2-carboxylate.
| Compound Name | (2,5-dimethylphenyl)methyl 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 16594706 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 3-aminopyrazine-2-carboxylate |
| SMILES | Cc1ccc(C)c(COC(=O)c2nccnc2N)c1 |
| InChI | InChI=1S/C14H15N3O2/c1-9-3-4-10(2)11(7-9)8-19-14(18)12-13(15)17-6-5-16-12/h3-7H,8H2,1-2H3,(H2,15,17) |
| InChIKey | IRISYBJLZKJDSM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |