C12H14BrNO2 — CID 106206637
2-cyclobutylethyl 2-bromopyridine-3-carboxylate (PubChem CID 106206637) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 2-cyclobutylethyl 2-bromopyridine-3-carboxylate.
| Compound Name | 2-cyclobutylethyl 2-bromopyridine-3-carboxylate |
|---|---|
| PubChem CID | 106206637 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-cyclobutylethyl 2-bromopyridine-3-carboxylate |
| SMILES | O=C(OCCC1CCC1)c1cccnc1Br |
| InChI | InChI=1S/C12H14BrNO2/c13-11-10(5-2-7-14-11)12(15)16-8-6-9-3-1-4-9/h2,5,7,9H,1,3-4,6,8H2 |
| InChIKey | QDNISSBYOQNUOY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|