C13H18O2S — CID 116523197
2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenol (PubChem CID 116523197) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenol.
| Compound Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 116523197 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenol |
| SMILES | CC1(C)CCC(CSc2ccccc2O)O1 |
| InChI | InChI=1S/C13H18O2S/c1-13(2)8-7-10(15-13)9-16-12-6-4-3-5-11(12)14/h3-6,10,14H,7-9H2,1-2H3 |
| InChIKey | ZHVBTZNQIFRNOI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |