C13H16Br2F2N2 — CID 114226017
[1-(2,5-dibromophenyl)-2-(3,3-difluorocyclopentyl)ethyl]hydrazine (PubChem CID 114226017) has the molecular formula C13H16Br2F2N2 and a molecular weight of 398.09 g/mol. Its IUPAC name is [1-(2,5-dibromophenyl)-2-(3,3-difluorocyclopentyl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dibromophenyl)-2-(3,3-difluorocyclopentyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114226017 |
| Molecular Formula | C13H16Br2F2N2 |
| Molecular Weight | 398.09 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | [1-(2,5-dibromophenyl)-2-(3,3-difluorocyclopentyl)ethyl]hydrazine |
| SMILES | NNC(CC1CCC(F)(F)C1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H16Br2F2N2/c14-9-1-2-11(15)10(6-9)12(19-18)5-8-3-4-13(16,17)7-8/h1-2,6,8,12,19H,3-5,7,18H2 |
| InChIKey | VNMFUHKMHMIGAU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.09 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|