C14H20ClF2N3 — CID 114225965
5-chloro-2-[2-(3,3-difluorocyclohexyl)-1-hydrazinylethyl]aniline (PubChem CID 114225965) has the molecular formula C14H20ClF2N3 and a molecular weight of 303.78 g/mol. Its IUPAC name is 5-chloro-2-[2-(3,3-difluorocyclohexyl)-1-hydrazinylethyl]aniline.
| Compound Name | 5-chloro-2-[2-(3,3-difluorocyclohexyl)-1-hydrazinylethyl]aniline |
|---|---|
| PubChem CID | 114225965 |
| Molecular Formula | C14H20ClF2N3 |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-chloro-2-[2-(3,3-difluorocyclohexyl)-1-hydrazinylethyl]aniline |
| SMILES | NNC(CC1CCCC(F)(F)C1)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C14H20ClF2N3/c15-10-3-4-11(12(18)7-10)13(20-19)6-9-2-1-5-14(16,17)8-9/h3-4,7,9,13,20H,1-2,5-6,8,18-19H2 |
| InChIKey | BERJFSJIWSYOKS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|