C14H22F2N2O — CID 114226056
[2-(3,3-difluorocyclohexyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine (PubChem CID 114226056) has the molecular formula C14H22F2N2O and a molecular weight of 272.34 g/mol. Its IUPAC name is [2-(3,3-difluorocyclohexyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3,3-difluorocyclohexyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114226056 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | [2-(3,3-difluorocyclohexyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine |
| SMILES | Cc1cc(C(CC2CCCC(F)(F)C2)NN)c(C)o1 |
| InChI | InChI=1S/C14H22F2N2O/c1-9-6-12(10(2)19-9)13(18-17)7-11-4-3-5-14(15,16)8-11/h6,11,13,18H,3-5,7-8,17H2,1-2H3 |
| InChIKey | CBGXCHXLPHXFDP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|