C13H18ClF2N3 — CID 114225964
5-chloro-2-[2-(3,3-difluorocyclopentyl)-1-hydrazinylethyl]aniline (PubChem CID 114225964) has the molecular formula C13H18ClF2N3 and a molecular weight of 289.76 g/mol. Its IUPAC name is 5-chloro-2-[2-(3,3-difluorocyclopentyl)-1-hydrazinylethyl]aniline.
| Compound Name | 5-chloro-2-[2-(3,3-difluorocyclopentyl)-1-hydrazinylethyl]aniline |
|---|---|
| PubChem CID | 114225964 |
| Molecular Formula | C13H18ClF2N3 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-chloro-2-[2-(3,3-difluorocyclopentyl)-1-hydrazinylethyl]aniline |
| SMILES | NNC(CC1CCC(F)(F)C1)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C13H18ClF2N3/c14-9-1-2-10(11(17)6-9)12(19-18)5-8-3-4-13(15,16)7-8/h1-2,6,8,12,19H,3-5,7,17-18H2 |
| InChIKey | PIOVTXBQYKSNAC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|