C14H17BrF2O — CID 114225420
2-(4-bromophenyl)-3-(3,3-difluorocyclopentyl)propan-1-ol (PubChem CID 114225420) has the molecular formula C14H17BrF2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-(3,3-difluorocyclopentyl)propan-1-ol.
| Compound Name | 2-(4-bromophenyl)-3-(3,3-difluorocyclopentyl)propan-1-ol |
|---|---|
| PubChem CID | 114225420 |
| Molecular Formula | C14H17BrF2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-(4-bromophenyl)-3-(3,3-difluorocyclopentyl)propan-1-ol |
| SMILES | OCC(CC1CCC(F)(F)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrF2O/c15-13-3-1-11(2-4-13)12(9-18)7-10-5-6-14(16,17)8-10/h1-4,10,12,18H,5-9H2 |
| InChIKey | YPFZPCFKQXIXCA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |