C13H14N4S — CID 65496581
2-[1-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]cyclopropyl]acetonitrile (PubChem CID 65496581) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 2-[1-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 65496581 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-[1-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]cyclopropyl]acetonitrile |
| SMILES | N#CCC1(CSc2nc3ccc(N)cc3[nH]2)CC1 |
| InChI | InChI=1S/C13H14N4S/c14-6-5-13(3-4-13)8-18-12-16-10-2-1-9(15)7-11(10)17-12/h1-2,7H,3-5,8,15H2,(H,16,17) |
| InChIKey | FSSTZWBERKARFC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|