C15H12N4S — CID 81276009
4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-2-methylbenzonitrile (PubChem CID 81276009) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-2-methylbenzonitrile.
| Compound Name | 4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 81276009 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-2-methylbenzonitrile |
| SMILES | Cc1cc(Sc2nc3ccc(N)cc3[nH]2)ccc1C#N |
| InChI | InChI=1S/C15H12N4S/c1-9-6-12(4-2-10(9)8-16)20-15-18-13-5-3-11(17)7-14(13)19-15/h2-7H,17H2,1H3,(H,18,19) |
| InChIKey | CPTWULNWTOUYMT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|