C15H11N3S — CID 102818482
3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]benzonitrile (PubChem CID 102818482) has the molecular formula C15H11N3S and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]benzonitrile.
| Compound Name | 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 102818482 |
| Molecular Formula | C15H11N3S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]benzonitrile |
| SMILES | Cc1ccc2nc(Sc3cccc(C#N)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H11N3S/c1-10-5-6-13-14(7-10)18-15(17-13)19-12-4-2-3-11(8-12)9-16/h2-8H,1H3,(H,17,18) |
| InChIKey | QYIDKYMZKRZSCB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |