C17H13ClN4OS — CID 144997221
2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-methyl-1H-indazol-3-yl)ethanone (PubChem CID 144997221) has the molecular formula C17H13ClN4OS and a molecular weight of 356.84 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-methyl-1H-indazol-3-yl)ethanone.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-methyl-1H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 144997221 |
| Molecular Formula | C17H13ClN4OS |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-methyl-1H-indazol-3-yl)ethanone |
| SMILES | Cc1ccc2c(C(=O)CSc3nc4ccc(Cl)cc4[nH]3)n[nH]c2c1 |
| InChI | InChI=1S/C17H13ClN4OS/c1-9-2-4-11-13(6-9)21-22-16(11)15(23)8-24-17-19-12-5-3-10(18)7-14(12)20-17/h2-7H,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | NWQMLUOXISNJNF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |