C17H12Cl2N4OS — CID 118649512
2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-chloro-1-methylindazol-3-yl)ethanone (PubChem CID 118649512) has the molecular formula C17H12Cl2N4OS and a molecular weight of 391.28 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-chloro-1-methylindazol-3-yl)ethanone.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-chloro-1-methylindazol-3-yl)ethanone |
|---|---|
| PubChem CID | 118649512 |
| Molecular Formula | C17H12Cl2N4OS |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-(6-chloro-1-methylindazol-3-yl)ethanone |
| SMILES | Cn1nc(C(=O)CSc2nc3ccc(Cl)cc3[nH]2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H12Cl2N4OS/c1-23-14-7-10(19)2-4-11(14)16(22-23)15(24)8-25-17-20-12-5-3-9(18)6-13(12)21-17/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | MRVDCHWJMNUCKH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |