C13H14ClN3O2S — CID 863936
2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-morpholin-4-ylethanone (PubChem CID 863936) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 863936 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-1-morpholin-4-ylethanone |
| SMILES | O=C(CSc1nc2ccc(Cl)cc2[nH]1)N1CCOCC1 |
| InChI | InChI=1S/C13H14ClN3O2S/c14-9-1-2-10-11(7-9)16-13(15-10)20-8-12(18)17-3-5-19-6-4-17/h1-2,7H,3-6,8H2,(H,15,16) |
| InChIKey | AVTGUNMDSUGZMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |