C16H18ClN3O2 — CID 10615622
(E)-3-(6-chloro-1H-benzimidazol-2-yl)-2-methyl-1-morpholin-4-ylbut-2-en-1-one (PubChem CID 10615622) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is (E)-3-(6-chloro-1H-benzimidazol-2-yl)-2-methyl-1-morpholin-4-ylbut-2-en-1-one.
| Compound Name | (E)-3-(6-chloro-1H-benzimidazol-2-yl)-2-methyl-1-morpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 10615622 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (E)-3-(6-chloro-1H-benzimidazol-2-yl)-2-methyl-1-morpholin-4-ylbut-2-en-1-one |
| SMILES | C/C(C(=O)N1CCOCC1)=C(/C)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-10(11(2)16(21)20-5-7-22-8-6-20)15-18-13-4-3-12(17)9-14(13)19-15/h3-4,9H,5-8H2,1-2H3,(H,18,19)/b11-10+ |
| InChIKey | RAHYFAXHDYZJOO-ZHACJKMWSA-N |
| XLogP | 2.87 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|