C16H16ClN3OS — CID 19866646
2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-4-methoxy-N,N-dimethylaniline (PubChem CID 19866646) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-4-methoxy-N,N-dimethylaniline.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-4-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 19866646 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-4-methoxy-N,N-dimethylaniline |
| SMILES | COc1ccc(N(C)C)c(Sc2nc3ccc(Cl)cc3[nH]2)c1 |
| InChI | InChI=1S/C16H16ClN3OS/c1-20(2)14-7-5-11(21-3)9-15(14)22-16-18-12-6-4-10(17)8-13(12)19-16/h4-9H,1-3H3,(H,18,19) |
| InChIKey | BJVYGSRVBIYBRY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|