C12H9ClN4OS — CID 78844133
6-chloro-2-(4-methoxypyrimidin-2-yl)sulfanyl-1H-benzimidazole (PubChem CID 78844133) has the molecular formula C12H9ClN4OS and a molecular weight of 292.75 g/mol. Its IUPAC name is 6-chloro-2-(4-methoxypyrimidin-2-yl)sulfanyl-1H-benzimidazole.
| Compound Name | 6-chloro-2-(4-methoxypyrimidin-2-yl)sulfanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 78844133 |
| Molecular Formula | C12H9ClN4OS |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 6-chloro-2-(4-methoxypyrimidin-2-yl)sulfanyl-1H-benzimidazole |
| SMILES | COc1ccnc(Sc2nc3ccc(Cl)cc3[nH]2)n1 |
| InChI | InChI=1S/C12H9ClN4OS/c1-18-10-4-5-14-11(17-10)19-12-15-8-3-2-7(13)6-9(8)16-12/h2-6H,1H3,(H,15,16) |
| InChIKey | WSFLGMVHAHLPQW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |