C23H16ClN3O2S — CID 22333215
7-chloro-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 22333215) has the molecular formula C23H16ClN3O2S and a molecular weight of 433.92 g/mol. Its IUPAC name is 7-chloro-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 7-chloro-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22333215 |
| Molecular Formula | C23H16ClN3O2S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 7-chloro-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | COc1ccc2nc(Sc3c(-c4ccccc4)c4ccc(Cl)cc4[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C23H16ClN3O2S/c1-29-15-8-10-17-19(12-15)27-23(26-17)30-21-20(13-5-3-2-4-6-13)16-9-7-14(24)11-18(16)25-22(21)28/h2-12H,1H3,(H,25,28)(H,26,27) |
| InChIKey | ZLLVVXYEZWBWCU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |