C22H18ClN3O2S — CID 146253649
6-chloro-3-[4-(2-methoxyethyl)pyrimidin-2-yl]sulfanyl-4-phenyl-1H-quinolin-2-one (PubChem CID 146253649) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is 6-chloro-3-[4-(2-methoxyethyl)pyrimidin-2-yl]sulfanyl-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[4-(2-methoxyethyl)pyrimidin-2-yl]sulfanyl-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 146253649 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 6-chloro-3-[4-(2-methoxyethyl)pyrimidin-2-yl]sulfanyl-4-phenyl-1H-quinolin-2-one |
| SMILES | COCCc1ccnc(Sc2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)n1 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-28-12-10-16-9-11-24-22(25-16)29-20-19(14-5-3-2-4-6-14)17-13-15(23)7-8-18(17)26-21(20)27/h2-9,11,13H,10,12H2,1H3,(H,26,27) |
| InChIKey | JFLWTUUDOFHBCK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |