C18H14ClNO3S — CID 4157880
3-[(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)sulfanyl]propanoic acid (PubChem CID 4157880) has the molecular formula C18H14ClNO3S and a molecular weight of 359.83 g/mol. Its IUPAC name is 3-[(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 4157880 |
| Molecular Formula | C18H14ClNO3S |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 3-[(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSc1c(-c2ccccc2)c2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C18H14ClNO3S/c19-12-6-7-14-13(10-12)16(11-4-2-1-3-5-11)17(18(23)20-14)24-9-8-15(21)22/h1-7,10H,8-9H2,(H,20,23)(H,21,22) |
| InChIKey | RAKBEACLWXHGDJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |