C12H6ClF3N4S — CID 133416039
6-chloro-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1H-benzimidazole (PubChem CID 133416039) has the molecular formula C12H6ClF3N4S and a molecular weight of 330.72 g/mol. Its IUPAC name is 6-chloro-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1H-benzimidazole.
| Compound Name | 6-chloro-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 133416039 |
| Molecular Formula | C12H6ClF3N4S |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 6-chloro-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1H-benzimidazole |
| SMILES | FC(F)(F)c1ccc(Sc2nc3ccc(Cl)cc3[nH]2)nn1 |
| InChI | InChI=1S/C12H6ClF3N4S/c13-6-1-2-7-8(5-6)18-11(17-7)21-10-4-3-9(19-20-10)12(14,15)16/h1-5H,(H,17,18) |
| InChIKey | TZQXENGLJQYRIJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |