C14H13ClN4S — CID 63731224
2-(6-chloro-5-propylpyrimidin-4-yl)sulfanyl-1H-benzimidazole (PubChem CID 63731224) has the molecular formula C14H13ClN4S and a molecular weight of 304.81 g/mol. Its IUPAC name is 2-(6-chloro-5-propylpyrimidin-4-yl)sulfanyl-1H-benzimidazole.
| Compound Name | 2-(6-chloro-5-propylpyrimidin-4-yl)sulfanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 63731224 |
| Molecular Formula | C14H13ClN4S |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(6-chloro-5-propylpyrimidin-4-yl)sulfanyl-1H-benzimidazole |
| SMILES | CCCc1c(Cl)ncnc1Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H13ClN4S/c1-2-5-9-12(15)16-8-17-13(9)20-14-18-10-6-3-4-7-11(10)19-14/h3-4,6-8H,2,5H2,1H3,(H,18,19) |
| InChIKey | NBBVQDMGYFLPRC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |