C13H12ClN5S — CID 62887222
[6-(1H-benzimidazol-2-ylsulfanylmethyl)-5-chloro-2-pyridinyl]hydrazine (PubChem CID 62887222) has the molecular formula C13H12ClN5S and a molecular weight of 305.79 g/mol. Its IUPAC name is [6-(1H-benzimidazol-2-ylsulfanylmethyl)-5-chloro-2-pyridinyl]hydrazine.
| Compound Name | [6-(1H-benzimidazol-2-ylsulfanylmethyl)-5-chloro-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62887222 |
| Molecular Formula | C13H12ClN5S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [6-(1H-benzimidazol-2-ylsulfanylmethyl)-5-chloro-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(Cl)c(CSc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C13H12ClN5S/c14-8-5-6-12(19-15)16-11(8)7-20-13-17-9-3-1-2-4-10(9)18-13/h1-6H,7,15H2,(H,16,19)(H,17,18) |
| InChIKey | ZLRXMEGCAHOOCW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|