C15H13ClN4O2S — CID 10337843
ethyl 2-(1H-benzimidazol-2-ylsulfanylmethyl)-4-chloropyrimidine-5-carboxylate (PubChem CID 10337843) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is ethyl 2-(1H-benzimidazol-2-ylsulfanylmethyl)-4-chloropyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(1H-benzimidazol-2-ylsulfanylmethyl)-4-chloropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10337843 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | ethyl 2-(1H-benzimidazol-2-ylsulfanylmethyl)-4-chloropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CSc2nc3ccccc3[nH]2)nc1Cl |
| InChI | InChI=1S/C15H13ClN4O2S/c1-2-22-14(21)9-7-17-12(20-13(9)16)8-23-15-18-10-5-3-4-6-11(10)19-15/h3-7H,2,8H2,1H3,(H,18,19) |
| InChIKey | FXDSQXJFUUCISI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |