C14H19N3O2S — CID 63034322
ethyl 4-(1H-benzimidazol-2-ylsulfanyl)-2-(methylamino)butanoate (PubChem CID 63034322) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is ethyl 4-(1H-benzimidazol-2-ylsulfanyl)-2-(methylamino)butanoate.
| Compound Name | ethyl 4-(1H-benzimidazol-2-ylsulfanyl)-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 63034322 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 4-(1H-benzimidazol-2-ylsulfanyl)-2-(methylamino)butanoate |
| SMILES | CCOC(=O)C(CCSc1nc2ccccc2[nH]1)NC |
| InChI | InChI=1S/C14H19N3O2S/c1-3-19-13(18)12(15-2)8-9-20-14-16-10-6-4-5-7-11(10)17-14/h4-7,12,15H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | TUKZTRXMZIUYSU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |