C20H16ClN3S2 — CID 139635710
2-[[4-(4-chlorophenyl)sulfanyl-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 139635710) has the molecular formula C20H16ClN3S2 and a molecular weight of 397.96 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)sulfanyl-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[[4-(4-chlorophenyl)sulfanyl-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 139635710 |
| Molecular Formula | C20H16ClN3S2 |
| Molecular Weight | 397.96 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)sulfanyl-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | Cc1c(Sc2ccc(Cl)cc2)ccnc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H16ClN3S2/c1-13-18(12-25-20-23-16-4-2-3-5-17(16)24-20)22-11-10-19(13)26-15-8-6-14(21)7-9-15/h2-11H,12H2,1H3,(H,23,24) |
| InChIKey | NTAXVJSCAGWPCE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.96 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |