C17H18IN3OS — CID 89147872
2-[[4-(3-iodopropoxy)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 89147872) has the molecular formula C17H18IN3OS and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-[[4-(3-iodopropoxy)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[[4-(3-iodopropoxy)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 89147872 |
| Molecular Formula | C17H18IN3OS |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 2-[[4-(3-iodopropoxy)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | Cc1c(OCCCI)ccnc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H18IN3OS/c1-12-15(19-9-7-16(12)22-10-4-8-18)11-23-17-20-13-5-2-3-6-14(13)21-17/h2-3,5-7,9H,4,8,10-11H2,1H3,(H,20,21) |
| InChIKey | IYOMEUMUHLSUSS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|